C16H15BrO4 — CID 121459680
2-(3,4-dihydroxyphenyl)ethyl 4-(bromomethyl)benzoate (PubChem CID 121459680) has the molecular formula C16H15BrO4 and a molecular weight of 351.20 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)ethyl 4-(bromomethyl)benzoate.
| Compound Name | 2-(3,4-dihydroxyphenyl)ethyl 4-(bromomethyl)benzoate |
|---|---|
| PubChem CID | 121459680 |
| Molecular Formula | C16H15BrO4 |
| Molecular Weight | 351.20 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)ethyl 4-(bromomethyl)benzoate |
| SMILES | O=C(OCCc1ccc(O)c(O)c1)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C16H15BrO4/c17-10-12-1-4-13(5-2-12)16(20)21-8-7-11-3-6-14(18)15(19)9-11/h1-6,9,18-19H,7-8,10H2 |
| InChIKey | RGXGDSBCTUQQFN-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.20 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|