About [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate
[4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate (PubChem CID 19792326) has the molecular formula C16H12Br2O4
and a molecular weight of 428.08 g/mol. Its IUPAC name is [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate.
Molecular Properties
| Compound Name | [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate |
| PubChem CID | 19792326 |
| Molecular Formula | C16H12Br2O4 |
| Molecular Weight | 428.08 g/mol |
| Exact Mass | 425.91 |
| IUPAC Name | [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate |
| SMILES | O=C(OOC(=O)c1ccc(CBr)cc1)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C16H12Br2O4/c17-9-11-1-5-13(6-2-11)15(19)21-22-16(20)14-7-3-12(10-18)4-8-14/h1-8H,9-10H2 |
| InChIKey | VSHNCYIYGHIQAC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.08 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate?
The IUPAC name of [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate (CID 19792326) is [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate.
What is the SMILES notation for [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate?
The canonical SMILES for [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate is O=C(OOC(=O)c1ccc(CBr)cc1)c1ccc(CBr)cc1.
What is the InChIKey of [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate?
The InChIKey is VSHNCYIYGHIQAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12Br2O4/c17-9-11-1-5-13(6-2-11)15(19)21-22-16(20)14-7-3-12(10-18)4-8-14/h1-8H,9-10H2.
What are the key properties of [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate?
[4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate has a molecular weight of 428.08 g/mol, XLogP of 4.41, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(bromomethyl)benzoyl] 4-(bromomethyl)benzenecarboperoxoate is sourced from PubChem (CID 19792326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).