About 4-(bromomethyl)benzoic acid;hydrobromide
4-(bromomethyl)benzoic acid;hydrobromide (PubChem CID 67089483) has the molecular formula C8H8Br2O2
and a molecular weight of 295.96 g/mol. Its IUPAC name is 4-(bromomethyl)benzoic acid;hydrobromide.
Molecular Properties
| Compound Name | 4-(bromomethyl)benzoic acid;hydrobromide |
| PubChem CID | 67089483 |
| Molecular Formula | C8H8Br2O2 |
| Molecular Weight | 295.96 g/mol |
| Exact Mass | 293.89 |
| IUPAC Name | 4-(bromomethyl)benzoic acid;hydrobromide |
| SMILES | Br.O=C(O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C8H7BrO2.BrH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4H,5H2,(H,10,11);1H |
| InChIKey | UEIWLWCFJPPEQR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.96 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)benzoic acid;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)benzoic acid;hydrobromide?
The IUPAC name of 4-(bromomethyl)benzoic acid;hydrobromide (CID 67089483) is 4-(bromomethyl)benzoic acid;hydrobromide.
What is the SMILES notation for 4-(bromomethyl)benzoic acid;hydrobromide?
The canonical SMILES for 4-(bromomethyl)benzoic acid;hydrobromide is Br.O=C(O)c1ccc(CBr)cc1.
What is the InChIKey of 4-(bromomethyl)benzoic acid;hydrobromide?
The InChIKey is UEIWLWCFJPPEQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2.BrH/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4H,5H2,(H,10,11);1H.
What are the key properties of 4-(bromomethyl)benzoic acid;hydrobromide?
4-(bromomethyl)benzoic acid;hydrobromide has a molecular weight of 295.96 g/mol, XLogP of 2.86, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)benzoic acid;hydrobromide is sourced from PubChem (CID 67089483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).