About 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride
4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride (PubChem CID 159319384) has the molecular formula C16H13Br2Cl3O4S
and a molecular weight of 567.51 g/mol. Its IUPAC name is 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride.
Molecular Properties
| Compound Name | 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride |
| PubChem CID | 159319384 |
| Molecular Formula | C16H13Br2Cl3O4S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 563.80 |
| IUPAC Name | 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride |
| SMILES | O=C(Cl)c1ccc(CBr)cc1.O=C(O)c1ccc(CBr)cc1.O=S(Cl)Cl |
| InChI | InChI=1S/C8H6BrClO.C8H7BrO2.Cl2OS/c2*9-5-6-1-3-7(4-2-6)8(10)11;1-4(2)3/h1-4H,5H2;1-4H,5H2,(H,10,11); |
| InChIKey | LDOCOZOKDWQMON-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride?
The IUPAC name of 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride (CID 159319384) is 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride.
What is the SMILES notation for 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride?
The canonical SMILES for 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride is O=C(Cl)c1ccc(CBr)cc1.O=C(O)c1ccc(CBr)cc1.O=S(Cl)Cl.
What is the InChIKey of 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride?
The InChIKey is LDOCOZOKDWQMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrClO.C8H7BrO2.Cl2OS/c2*9-5-6-1-3-7(4-2-6)8(10)11;1-4(2)3/h1-4H,5H2;1-4H,5H2,(H,10,11);.
What are the key properties of 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride?
4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride has a molecular weight of 567.51 g/mol, XLogP of 6.28, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)benzoic acid;4-(bromomethyl)benzoyl chloride;thionyl dichloride is sourced from PubChem (CID 159319384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).