About sodium 4-(bromomethyl)benzoate
sodium 4-(bromomethyl)benzoate (PubChem CID 23662147) has the molecular formula C8H6BrNaO2
and a molecular weight of 237.03 g/mol. Its IUPAC name is sodium 4-(bromomethyl)benzoate.
Molecular Properties
| Compound Name | sodium 4-(bromomethyl)benzoate |
| PubChem CID | 23662147 |
| Molecular Formula | C8H6BrNaO2 |
| Molecular Weight | 237.03 g/mol |
| Exact Mass | 235.94 |
| IUPAC Name | sodium 4-(bromomethyl)benzoate |
| SMILES | O=C([O-])c1ccc(CBr)cc1.[Na+] |
| InChI | InChI=1S/C8H7BrO2.Na/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4H,5H2,(H,10,11);/q;+1/p-1 |
| InChIKey | WJPOAFLWYKDNIB-UHFFFAOYSA-M |
| XLogP | -2.05 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.03 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze sodium 4-(bromomethyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 4-(bromomethyl)benzoate?
The IUPAC name of sodium 4-(bromomethyl)benzoate (CID 23662147) is sodium 4-(bromomethyl)benzoate.
What is the SMILES notation for sodium 4-(bromomethyl)benzoate?
The canonical SMILES for sodium 4-(bromomethyl)benzoate is O=C([O-])c1ccc(CBr)cc1.[Na+].
What is the InChIKey of sodium 4-(bromomethyl)benzoate?
The InChIKey is WJPOAFLWYKDNIB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H7BrO2.Na/c9-5-6-1-3-7(4-2-6)8(10)11;/h1-4H,5H2,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 4-(bromomethyl)benzoate?
sodium 4-(bromomethyl)benzoate has a molecular weight of 237.03 g/mol, XLogP of -2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 4-(bromomethyl)benzoate is sourced from PubChem (CID 23662147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).