About 4-(2-bromoacetyl)benzoyl chloride
4-(2-bromoacetyl)benzoyl chloride (PubChem CID 57372356) has the molecular formula C9H6BrClO2
and a molecular weight of 261.50 g/mol. Its IUPAC name is 4-(2-bromoacetyl)benzoyl chloride.
Molecular Properties
| Compound Name | 4-(2-bromoacetyl)benzoyl chloride |
| PubChem CID | 57372356 |
| Molecular Formula | C9H6BrClO2 |
| Molecular Weight | 261.50 g/mol |
| Exact Mass | 259.92 |
| IUPAC Name | 4-(2-bromoacetyl)benzoyl chloride |
| SMILES | O=C(Cl)c1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C9H6BrClO2/c10-5-8(12)6-1-3-7(4-2-6)9(11)13/h1-4H,5H2 |
| InChIKey | IHQYMAKUCBRROU-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.50 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoacetyl)benzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoacetyl)benzoyl chloride?
The IUPAC name of 4-(2-bromoacetyl)benzoyl chloride (CID 57372356) is 4-(2-bromoacetyl)benzoyl chloride.
What is the SMILES notation for 4-(2-bromoacetyl)benzoyl chloride?
The canonical SMILES for 4-(2-bromoacetyl)benzoyl chloride is O=C(Cl)c1ccc(C(=O)CBr)cc1.
What is the InChIKey of 4-(2-bromoacetyl)benzoyl chloride?
The InChIKey is IHQYMAKUCBRROU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6BrClO2/c10-5-8(12)6-1-3-7(4-2-6)9(11)13/h1-4H,5H2.
What are the key properties of 4-(2-bromoacetyl)benzoyl chloride?
4-(2-bromoacetyl)benzoyl chloride has a molecular weight of 261.50 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoacetyl)benzoyl chloride is sourced from PubChem (CID 57372356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).