About 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone
2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone (PubChem CID 143457171) has the molecular formula C20H25BrO2
and a molecular weight of 377.32 g/mol. Its IUPAC name is 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone |
| PubChem CID | 143457171 |
| Molecular Formula | C20H25BrO2 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone |
| SMILES | CC.CC(=O)c1ccc(C)cc1.Cc1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C9H9BrO.C9H10O.C2H6/c1-7-2-4-8(5-3-7)9(11)6-10;1-7-3-5-9(6-4-7)8(2)10;1-2/h2-5H,6H2,1H3;3-6H,1-2H3;1-2H3 |
| InChIKey | KIISFIGKXSETIC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone?
The IUPAC name of 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone (CID 143457171) is 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone.
What is the SMILES notation for 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone?
The canonical SMILES for 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone is CC.CC(=O)c1ccc(C)cc1.Cc1ccc(C(=O)CBr)cc1.
What is the InChIKey of 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone?
The InChIKey is KIISFIGKXSETIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrO.C9H10O.C2H6/c1-7-2-4-8(5-3-7)9(11)6-10;1-7-3-5-9(6-4-7)8(2)10;1-2/h2-5H,6H2,1H3;3-6H,1-2H3;1-2H3.
What are the key properties of 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone?
2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone has a molecular weight of 377.32 g/mol, XLogP of 5.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(4-methylphenyl)ethanone;ethane;1-(4-methylphenyl)ethanone is sourced from PubChem (CID 143457171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).