About 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone
2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone (PubChem CID 159611000) has the molecular formula C16H13BrI2O2
and a molecular weight of 570.99 g/mol. Its IUPAC name is 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone.
Molecular Properties
| Compound Name | 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone |
| PubChem CID | 159611000 |
| Molecular Formula | C16H13BrI2O2 |
| Molecular Weight | 570.99 g/mol |
| Exact Mass | 569.82 |
| IUPAC Name | 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone |
| SMILES | CC(=O)c1ccc(I)cc1.O=C(CBr)c1ccc(I)cc1 |
| InChI | InChI=1S/C8H6BrIO.C8H7IO/c9-5-8(11)6-1-3-7(10)4-2-6;1-6(10)7-2-4-8(9)5-3-7/h1-4H,5H2;2-5H,1H3 |
| InChIKey | MMROLQZURLGIPU-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.99 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone?
The IUPAC name of 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone (CID 159611000) is 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone.
What is the SMILES notation for 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone?
The canonical SMILES for 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone is CC(=O)c1ccc(I)cc1.O=C(CBr)c1ccc(I)cc1.
What is the InChIKey of 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone?
The InChIKey is MMROLQZURLGIPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrIO.C8H7IO/c9-5-8(11)6-1-3-7(10)4-2-6;1-6(10)7-2-4-8(9)5-3-7/h1-4H,5H2;2-5H,1H3.
What are the key properties of 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone?
2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone has a molecular weight of 570.99 g/mol, XLogP of 5.36, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-(4-iodophenyl)ethanone;1-(4-iodophenyl)ethanone is sourced from PubChem (CID 159611000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).