About ethane;1-(4-iodophenyl)ethanone
ethane;1-(4-iodophenyl)ethanone (PubChem CID 159760217) has the molecular formula C10H13IO
and a molecular weight of 276.12 g/mol. Its IUPAC name is ethane;1-(4-iodophenyl)ethanone.
Molecular Properties
| Compound Name | ethane;1-(4-iodophenyl)ethanone |
| PubChem CID | 159760217 |
| Molecular Formula | C10H13IO |
| Molecular Weight | 276.12 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | ethane;1-(4-iodophenyl)ethanone |
| SMILES | CC.CC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C8H7IO.C2H6/c1-6(10)7-2-4-8(9)5-3-7;1-2/h2-5H,1H3;1-2H3 |
| InChIKey | NETWGSJWZBTUQT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-(4-iodophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-(4-iodophenyl)ethanone?
The IUPAC name of ethane;1-(4-iodophenyl)ethanone (CID 159760217) is ethane;1-(4-iodophenyl)ethanone.
What is the SMILES notation for ethane;1-(4-iodophenyl)ethanone?
The canonical SMILES for ethane;1-(4-iodophenyl)ethanone is CC.CC(=O)c1ccc(I)cc1.
What is the InChIKey of ethane;1-(4-iodophenyl)ethanone?
The InChIKey is NETWGSJWZBTUQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO.C2H6/c1-6(10)7-2-4-8(9)5-3-7;1-2/h2-5H,1H3;1-2H3.
What are the key properties of ethane;1-(4-iodophenyl)ethanone?
ethane;1-(4-iodophenyl)ethanone has a molecular weight of 276.12 g/mol, XLogP of 3.52, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-(4-iodophenyl)ethanone is sourced from PubChem (CID 159760217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).