About bromomethane;2-bromo-1-phenylethanone;ethane
bromomethane;2-bromo-1-phenylethanone;ethane (PubChem CID 90907138) has the molecular formula C11H16Br2O
and a molecular weight of 324.06 g/mol. Its IUPAC name is bromomethane;2-bromo-1-phenylethanone;ethane.
Molecular Properties
| Compound Name | bromomethane;2-bromo-1-phenylethanone;ethane |
| PubChem CID | 90907138 |
| Molecular Formula | C11H16Br2O |
| Molecular Weight | 324.06 g/mol |
| Exact Mass | 321.96 |
| IUPAC Name | bromomethane;2-bromo-1-phenylethanone;ethane |
| SMILES | CBr.CC.O=C(CBr)c1ccccc1 |
| InChI | InChI=1S/C8H7BrO.C2H6.CH3Br/c9-6-8(10)7-4-2-1-3-5-7;2*1-2/h1-5H,6H2;1-2H3;1H3 |
| InChIKey | QKHGLOCPNFSXRM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.06 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;2-bromo-1-phenylethanone;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;2-bromo-1-phenylethanone;ethane?
The IUPAC name of bromomethane;2-bromo-1-phenylethanone;ethane (CID 90907138) is bromomethane;2-bromo-1-phenylethanone;ethane.
What is the SMILES notation for bromomethane;2-bromo-1-phenylethanone;ethane?
The canonical SMILES for bromomethane;2-bromo-1-phenylethanone;ethane is CBr.CC.O=C(CBr)c1ccccc1.
What is the InChIKey of bromomethane;2-bromo-1-phenylethanone;ethane?
The InChIKey is QKHGLOCPNFSXRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO.C2H6.CH3Br/c9-6-8(10)7-4-2-1-3-5-7;2*1-2/h1-5H,6H2;1-2H3;1H3.
What are the key properties of bromomethane;2-bromo-1-phenylethanone;ethane?
bromomethane;2-bromo-1-phenylethanone;ethane has a molecular weight of 324.06 g/mol, XLogP of 4.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;2-bromo-1-phenylethanone;ethane is sourced from PubChem (CID 90907138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).