About 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate
2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate (PubChem CID 158529671) has the molecular formula C23H28O7S
and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate |
| PubChem CID | 158529671 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate |
| SMILES | Cc1ccc(CCOC(=O)CCSCCC(=O)OCCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C23H28O7S/c1-16-2-3-17(14-20(16)25)6-10-29-22(27)8-12-31-13-9-23(28)30-11-7-18-4-5-19(24)21(26)15-18/h2-5,14-15,24-26H,6-13H2,1H3 |
| InChIKey | HNFBWAPAYSRUKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate?
The IUPAC name of 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate (CID 158529671) is 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate.
What is the SMILES notation for 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate?
The canonical SMILES for 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate is Cc1ccc(CCOC(=O)CCSCCC(=O)OCCc2ccc(O)c(O)c2)cc1O.
What is the InChIKey of 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate?
The InChIKey is HNFBWAPAYSRUKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H28O7S/c1-16-2-3-17(14-20(16)25)6-10-29-22(27)8-12-31-13-9-23(28)30-11-7-18-4-5-19(24)21(26)15-18/h2-5,14-15,24-26H,6-13H2,1H3.
What are the key properties of 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate?
2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate has a molecular weight of 448.54 g/mol, XLogP of 3.50, 12 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate is sourced from PubChem (CID 158529671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).