C23H28O7S — CID 158529671
2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate (PubChem CID 158529671) has the molecular formula C23H28O7S and a molecular weight of 448.54 g/mol. Its IUPAC name is 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate.
| Compound Name | 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 158529671 |
| Molecular Formula | C23H28O7S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-(3-hydroxy-4-methylphenyl)ethyl 3-[3-[2-(3,4-dihydroxyphenyl)ethoxy]-3-oxopropyl]sulfanylpropanoate |
| SMILES | Cc1ccc(CCOC(=O)CCSCCC(=O)OCCc2ccc(O)c(O)c2)cc1O |
| InChI | InChI=1S/C23H28O7S/c1-16-2-3-17(14-20(16)25)6-10-29-22(27)8-12-31-13-9-23(28)30-11-7-18-4-5-19(24)21(26)15-18/h2-5,14-15,24-26H,6-13H2,1H3 |
| InChIKey | HNFBWAPAYSRUKF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|