C18H20O8 — CID 163397180
(Z)-3-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-2,4-diformylhex-4-enoic acid (PubChem CID 163397180) has the molecular formula C18H20O8 and a molecular weight of 364.35 g/mol. Its IUPAC name is (Z)-3-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-2,4-diformylhex-4-enoic acid.
| Compound Name | (Z)-3-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-2,4-diformylhex-4-enoic acid |
|---|---|
| PubChem CID | 163397180 |
| Molecular Formula | C18H20O8 |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | (Z)-3-[2-[2-(3,4-dihydroxyphenyl)ethoxy]-2-oxoethyl]-2,4-diformylhex-4-enoic acid |
| SMILES | C/C=C(\C=O)C(CC(=O)OCCc1ccc(O)c(O)c1)C(C=O)C(=O)O |
| InChI | InChI=1S/C18H20O8/c1-2-12(9-19)13(14(10-20)18(24)25)8-17(23)26-6-5-11-3-4-15(21)16(22)7-11/h2-4,7,9-10,13-14,21-22H,5-6,8H2,1H3,(H,24,25)/b12-2+ |
| InChIKey | VXYFRTSKUNZCGC-SWGQDTFXSA-N |
| XLogP | 1.23 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|