C17H22O5 — CID 171349750
2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(methoxymethyl)hex-4-enoate (PubChem CID 171349750) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(methoxymethyl)hex-4-enoate.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(methoxymethyl)hex-4-enoate |
|---|---|
| PubChem CID | 171349750 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(methoxymethyl)hex-4-enoate |
| SMILES | C/C=C(/C=O)[C@@H](COC)CC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C17H22O5/c1-3-14(11-18)15(12-21-2)10-17(20)22-9-8-13-4-6-16(19)7-5-13/h3-7,11,15,19H,8-10,12H2,1-2H3/b14-3-/t15-/m1/s1 |
| InChIKey | ADXUXBCEFRDYGI-QRKTZRNBSA-N |
| XLogP | 2.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|