C17H20O5 — CID 163255414
2-phenoxyethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate (PubChem CID 163255414) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 2-phenoxyethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate.
| Compound Name | 2-phenoxyethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
|---|---|
| PubChem CID | 163255414 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 2-phenoxyethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate |
| SMILES | C/C=C(/C=O)[C@@H](CC=O)CC(=O)OCCOc1ccccc1 |
| InChI | InChI=1S/C17H20O5/c1-2-14(13-19)15(8-9-18)12-17(20)22-11-10-21-16-6-4-3-5-7-16/h2-7,9,13,15H,8,10-12H2,1H3/b14-2-/t15-/m0/s1 |
| InChIKey | DOYWTURUEKVSDB-VAKDEWRISA-N |
| XLogP | 2.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|