C30H38O7 — CID 42596926
2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate;2-[4-(2-methylpropyl)phenyl]propanoic acid (PubChem CID 42596926) has the molecular formula C30H38O7 and a molecular weight of 510.63 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate;2-[4-(2-methylpropyl)phenyl]propanoic acid.
| Compound Name | 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate;2-[4-(2-methylpropyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 42596926 |
| Molecular Formula | C30H38O7 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (E,3S)-4-formyl-3-(2-oxoethyl)hex-4-enoate;2-[4-(2-methylpropyl)phenyl]propanoic acid |
| SMILES | C/C=C(/C=O)[C@@H](CC=O)CC(=O)OCCc1ccc(O)cc1.CC(C)Cc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C17H20O5.C13H18O2/c1-2-14(12-19)15(7-9-18)11-17(21)22-10-8-13-3-5-16(20)6-4-13;1-9(2)8-11-4-6-12(7-5-11)10(3)13(14)15/h2-6,9,12,15,20H,7-8,10-11H2,1H3;4-7,9-10H,8H2,1-3H3,(H,14,15)/b14-2-;/t15-;/m0./s1 |
| InChIKey | MLHSYMIUJXNJTH-AWXDTBNOSA-N |
| XLogP | 5.29 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|