About 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate
2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate (PubChem CID 163078675) has the molecular formula C11H14O4
and a molecular weight of 210.23 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate.
Molecular Properties
| Compound Name | 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate |
| PubChem CID | 163078675 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](O)C(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C11H14O4/c1-8(12)11(14)15-7-6-9-2-4-10(13)5-3-9/h2-5,8,12-13H,6-7H2,1H3/t8-/m0/s1 |
| InChIKey | MEIJOIQTTNXSGK-QMMMGPOBSA-N |
| XLogP | 0.86 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate?
The IUPAC name of 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate (CID 163078675) is 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate.
What is the SMILES notation for 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate?
The canonical SMILES for 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate is C[C@H](O)C(=O)OCCc1ccc(O)cc1.
What is the InChIKey of 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate?
The InChIKey is MEIJOIQTTNXSGK-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H14O4/c1-8(12)11(14)15-7-6-9-2-4-10(13)5-3-9/h2-5,8,12-13H,6-7H2,1H3/t8-/m0/s1.
What are the key properties of 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate?
2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate has a molecular weight of 210.23 g/mol, XLogP of 0.86, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxyphenyl)ethyl (2S)-2-hydroxypropanoate is sourced from PubChem (CID 163078675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).