C16H19NO8 — CID 25161267
5-[2-(4-hydroxyphenyl)ethoxy]-3-[(2-methoxy-2-oxoacetyl)amino]-5-oxopentanoic acid (PubChem CID 25161267) has the molecular formula C16H19NO8 and a molecular weight of 353.33 g/mol. Its IUPAC name is 5-[2-(4-hydroxyphenyl)ethoxy]-3-[(2-methoxy-2-oxoacetyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[2-(4-hydroxyphenyl)ethoxy]-3-[(2-methoxy-2-oxoacetyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 25161267 |
| Molecular Formula | C16H19NO8 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethoxy]-3-[(2-methoxy-2-oxoacetyl)amino]-5-oxopentanoic acid |
| SMILES | COC(=O)C(=O)NC(CC(=O)O)CC(=O)OCCc1ccc(O)cc1 |
| InChI | InChI=1S/C16H19NO8/c1-24-16(23)15(22)17-11(8-13(19)20)9-14(21)25-7-6-10-2-4-12(18)5-3-10/h2-5,11,18H,6-9H2,1H3,(H,17,22)(H,19,20) |
| InChIKey | QZTUFHQINKEEEJ-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|