C23H25NO8 — CID 25161265
5-O-benzyl 1-O-[2-(4-hydroxyphenyl)ethyl] 3-[(2-methoxy-2-oxoacetyl)amino]pentanedioate (PubChem CID 25161265) has the molecular formula C23H25NO8 and a molecular weight of 443.45 g/mol. Its IUPAC name is 5-O-benzyl 1-O-[2-(4-hydroxyphenyl)ethyl] 3-[(2-methoxy-2-oxoacetyl)amino]pentanedioate.
| Compound Name | 5-O-benzyl 1-O-[2-(4-hydroxyphenyl)ethyl] 3-[(2-methoxy-2-oxoacetyl)amino]pentanedioate |
|---|---|
| PubChem CID | 25161265 |
| Molecular Formula | C23H25NO8 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 5-O-benzyl 1-O-[2-(4-hydroxyphenyl)ethyl] 3-[(2-methoxy-2-oxoacetyl)amino]pentanedioate |
| SMILES | COC(=O)C(=O)NC(CC(=O)OCCc1ccc(O)cc1)CC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H25NO8/c1-30-23(29)22(28)24-18(14-21(27)32-15-17-5-3-2-4-6-17)13-20(26)31-12-11-16-7-9-19(25)10-8-16/h2-10,18,25H,11-15H2,1H3,(H,24,28) |
| InChIKey | LMIRAPWHXKNLEW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 128.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|