C36H54N4O6 — CID 162234835
3-[methyl-[(3E,5Z)-octa-3,5,7-trienoyl]amino]propyl 2-[3,3,5-trimethyl-5-[[3-[methyl(phenylcarbamoyl)amino]propoxycarbonylamino]methyl]cyclohexyl]acetate (PubChem CID 162234835) has the molecular formula C36H54N4O6 and a molecular weight of 638.85 g/mol. Its IUPAC name is 3-[methyl-[(3E,5Z)-octa-3,5,7-trienoyl]amino]propyl 2-[3,3,5-trimethyl-5-[[3-[methyl(phenylcarbamoyl)amino]propoxycarbonylamino]methyl]cyclohexyl]acetate.
| Compound Name | 3-[methyl-[(3E,5Z)-octa-3,5,7-trienoyl]amino]propyl 2-[3,3,5-trimethyl-5-[[3-[methyl(phenylcarbamoyl)amino]propoxycarbonylamino]methyl]cyclohexyl]acetate |
|---|---|
| PubChem CID | 162234835 |
| Molecular Formula | C36H54N4O6 |
| Molecular Weight | 638.85 g/mol |
| Exact Mass | 638.40 |
| IUPAC Name | 3-[methyl-[(3E,5Z)-octa-3,5,7-trienoyl]amino]propyl 2-[3,3,5-trimethyl-5-[[3-[methyl(phenylcarbamoyl)amino]propoxycarbonylamino]methyl]cyclohexyl]acetate |
| SMILES | C=C/C=C\C=C\CC(=O)N(C)CCCOC(=O)CC1CC(C)(C)CC(C)(CNC(=O)OCCCN(C)C(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C36H54N4O6/c1-7-8-9-10-14-19-31(41)39(5)20-15-22-45-32(42)24-29-25-35(2,3)27-36(4,26-29)28-37-34(44)46-23-16-21-40(6)33(43)38-30-17-12-11-13-18-30/h7-14,17-18,29H,1,15-16,19-28H2,2-6H3,(H,37,44)(H,38,43)/b9-8-,14-10+ |
| InChIKey | YJXLQDLRCCCMHT-MYSCJDEHSA-N |
| XLogP | 6.57 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.85 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|