C27H42N2O5 — CID 159485794
ethyl 2-[3-[[[5-(benzylamino)-5-oxopentoxy]carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate (PubChem CID 159485794) has the molecular formula C27H42N2O5 and a molecular weight of 474.64 g/mol. Its IUPAC name is ethyl 2-[3-[[[5-(benzylamino)-5-oxopentoxy]carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate.
| Compound Name | ethyl 2-[3-[[[5-(benzylamino)-5-oxopentoxy]carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate |
|---|---|
| PubChem CID | 159485794 |
| Molecular Formula | C27H42N2O5 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | ethyl 2-[3-[[[5-(benzylamino)-5-oxopentoxy]carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]acetate |
| SMILES | CCOC(=O)CC1CC(C)(C)CC(C)(CNC(=O)OCCCCC(=O)NCc2ccccc2)C1 |
| InChI | InChI=1S/C27H42N2O5/c1-5-33-24(31)15-22-16-26(2,3)19-27(4,17-22)20-29-25(32)34-14-10-9-13-23(30)28-18-21-11-7-6-8-12-21/h6-8,11-12,22H,5,9-10,13-20H2,1-4H3,(H,28,30)(H,29,32) |
| InChIKey | FFDQRKSHLKVAIB-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|