C28H43NO6 — CID 157145807
3-[2-[3,3,5-trimethyl-5-[(propan-2-yloxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl 3-phenylpropanoate (PubChem CID 157145807) has the molecular formula C28H43NO6 and a molecular weight of 489.65 g/mol. Its IUPAC name is 3-[2-[3,3,5-trimethyl-5-[(propan-2-yloxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl 3-phenylpropanoate.
| Compound Name | 3-[2-[3,3,5-trimethyl-5-[(propan-2-yloxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 157145807 |
| Molecular Formula | C28H43NO6 |
| Molecular Weight | 489.65 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | 3-[2-[3,3,5-trimethyl-5-[(propan-2-yloxycarbonylamino)methyl]cyclohexyl]acetyl]oxypropyl 3-phenylpropanoate |
| SMILES | CC(C)OC(=O)NCC1(C)CC(CC(=O)OCCCOC(=O)CCc2ccccc2)CC(C)(C)C1 |
| InChI | InChI=1S/C28H43NO6/c1-21(2)35-26(32)29-20-28(5)18-23(17-27(3,4)19-28)16-25(31)34-15-9-14-33-24(30)13-12-22-10-7-6-8-11-22/h6-8,10-11,21,23H,9,12-20H2,1-5H3,(H,29,32) |
| InChIKey | MZOQJMWKEBVQCW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.65 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|