C24H30N2O2S2 — CID 140658764
O-phenyl N-[[1,3,3-trimethyl-5-(phenylsulfanylcarbonylamino)cyclohexyl]methyl]carbamothioate (PubChem CID 140658764) has the molecular formula C24H30N2O2S2 and a molecular weight of 442.65 g/mol. Its IUPAC name is O-phenyl N-[[1,3,3-trimethyl-5-(phenylsulfanylcarbonylamino)cyclohexyl]methyl]carbamothioate.
| Compound Name | O-phenyl N-[[1,3,3-trimethyl-5-(phenylsulfanylcarbonylamino)cyclohexyl]methyl]carbamothioate |
|---|---|
| PubChem CID | 140658764 |
| Molecular Formula | C24H30N2O2S2 |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | O-phenyl N-[[1,3,3-trimethyl-5-(phenylsulfanylcarbonylamino)cyclohexyl]methyl]carbamothioate |
| SMILES | CC1(C)CC(NC(=O)Sc2ccccc2)CC(C)(CNC(=S)Oc2ccccc2)C1 |
| InChI | InChI=1S/C24H30N2O2S2/c1-23(2)14-18(26-21(27)30-20-12-8-5-9-13-20)15-24(3,16-23)17-25-22(29)28-19-10-6-4-7-11-19/h4-13,18H,14-17H2,1-3H3,(H,25,29)(H,26,27) |
| InChIKey | WNYJDOZEJZPWIA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|