C30H43N3O4 — CID 150416281
(2-propylphenyl) N-[[3,3,5-trimethyl-5-[[(2-propylphenoxy)carbonylamino]methyl]cyclohexyl]amino]carbamate (PubChem CID 150416281) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is (2-propylphenyl) N-[[3,3,5-trimethyl-5-[[(2-propylphenoxy)carbonylamino]methyl]cyclohexyl]amino]carbamate.
| Compound Name | (2-propylphenyl) N-[[3,3,5-trimethyl-5-[[(2-propylphenoxy)carbonylamino]methyl]cyclohexyl]amino]carbamate |
|---|---|
| PubChem CID | 150416281 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | (2-propylphenyl) N-[[3,3,5-trimethyl-5-[[(2-propylphenoxy)carbonylamino]methyl]cyclohexyl]amino]carbamate |
| SMILES | CCCc1ccccc1OC(=O)NCC1(C)CC(NNC(=O)Oc2ccccc2CCC)CC(C)(C)C1 |
| InChI | InChI=1S/C30H43N3O4/c1-6-12-22-14-8-10-16-25(22)36-27(34)31-21-30(5)19-24(18-29(3,4)20-30)32-33-28(35)37-26-17-11-9-15-23(26)13-7-2/h8-11,14-17,24,32H,6-7,12-13,18-21H2,1-5H3,(H,31,34)(H,33,35) |
| InChIKey | HGVVKSHUSSIJHP-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|