C44H70N2O4 — CID 67224751
(2,3-dipentylphenyl) N-[3-[[(2,3-dipentylphenoxy)carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate (PubChem CID 67224751) has the molecular formula C44H70N2O4 and a molecular weight of 691.05 g/mol. Its IUPAC name is (2,3-dipentylphenyl) N-[3-[[(2,3-dipentylphenoxy)carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate.
| Compound Name | (2,3-dipentylphenyl) N-[3-[[(2,3-dipentylphenoxy)carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 67224751 |
| Molecular Formula | C44H70N2O4 |
| Molecular Weight | 691.05 g/mol |
| Exact Mass | 690.53 |
| IUPAC Name | (2,3-dipentylphenyl) N-[3-[[(2,3-dipentylphenoxy)carbonylamino]methyl]-3,5,5-trimethylcyclohexyl]carbamate |
| SMILES | CCCCCc1cccc(OC(=O)NCC2(C)CC(NC(=O)Oc3cccc(CCCCC)c3CCCCC)CC(C)(C)C2)c1CCCCC |
| InChI | InChI=1S/C44H70N2O4/c1-8-12-16-22-34-24-20-28-39(37(34)26-18-14-10-3)49-41(47)45-33-44(7)31-36(30-43(5,6)32-44)46-42(48)50-40-29-21-25-35(23-17-13-9-2)38(40)27-19-15-11-4/h20-21,24-25,28-29,36H,8-19,22-23,26-27,30-33H2,1-7H3,(H,45,47)(H,46,48) |
| InChIKey | CWWSJWCOFLDGSX-UHFFFAOYSA-N |
| XLogP | 12.08 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.05 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|