C19H29NOS — CID 3005503
N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2,4-dimethylbenzenecarbothioamide (PubChem CID 3005503) has the molecular formula C19H29NOS and a molecular weight of 319.51 g/mol. Its IUPAC name is N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2,4-dimethylbenzenecarbothioamide.
| Compound Name | N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2,4-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 3005503 |
| Molecular Formula | C19H29NOS |
| Molecular Weight | 319.51 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | N-[[(1R,5R)-5-hydroxy-1,3,3-trimethylcyclohexyl]methyl]-2,4-dimethylbenzenecarbothioamide |
| SMILES | Cc1ccc(C(=S)NC[C@@]2(C)C[C@H](O)CC(C)(C)C2)c(C)c1 |
| InChI | InChI=1S/C19H29NOS/c1-13-6-7-16(14(2)8-13)17(22)20-12-19(5)10-15(21)9-18(3,4)11-19/h6-8,15,21H,9-12H2,1-5H3,(H,20,22)/t15-,19+/m1/s1 |
| InChIKey | QHRMEFPNGJEWJV-BEFAXECRSA-N |
| XLogP | 4.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|