C18H27N3S — CID 5012931
1-(2,4-dimethylphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]thiourea (PubChem CID 5012931) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]thiourea |
|---|---|
| PubChem CID | 5012931 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-[(3,3,5-trimethylcyclohexylidene)amino]thiourea |
| SMILES | Cc1ccc(NC(=S)NN=C2CC(C)CC(C)(C)C2)c(C)c1 |
| InChI | InChI=1S/C18H27N3S/c1-12-6-7-16(14(3)8-12)19-17(22)21-20-15-9-13(2)10-18(4,5)11-15/h6-8,13H,9-11H2,1-5H3,(H2,19,21,22) |
| InChIKey | QFBKOPMDKTWWEN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|