C13H18N2S — CID 15113012
1-(2,4-dimethylphenyl)-3-(2-methylprop-2-enyl)thiourea (PubChem CID 15113012) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 15113012 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C13H18N2S/c1-9(2)8-14-13(16)15-12-6-5-10(3)7-11(12)4/h5-7H,1,8H2,2-4H3,(H2,14,15,16) |
| InChIKey | MBHRDONDMJBXBM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|