C11H12F2N2S — CID 8668962
1-(2,5-difluorophenyl)-3-(2-methylprop-2-enyl)thiourea (PubChem CID 8668962) has the molecular formula C11H12F2N2S and a molecular weight of 242.29 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-(2,5-difluorophenyl)-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 8668962 |
| Molecular Formula | C11H12F2N2S |
| Molecular Weight | 242.29 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)Nc1cc(F)ccc1F |
| InChI | InChI=1S/C11H12F2N2S/c1-7(2)6-14-11(16)15-10-5-8(12)3-4-9(10)13/h3-5H,1,6H2,2H3,(H2,14,15,16) |
| InChIKey | ORCOHNNBRBUXOC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.29 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|