C13H14F3N3OS — CID 7945322
2-(2-methylprop-2-enylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 7945322) has the molecular formula C13H14F3N3OS and a molecular weight of 317.34 g/mol. Its IUPAC name is 2-(2-methylprop-2-enylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2-methylprop-2-enylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 7945322 |
| Molecular Formula | C13H14F3N3OS |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-(2-methylprop-2-enylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C=C(C)CNC(=S)NCC(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H14F3N3OS/c1-7(2)5-17-13(21)18-6-10(20)19-9-4-3-8(14)11(15)12(9)16/h3-4H,1,5-6H2,2H3,(H,19,20)(H2,17,18,21) |
| InChIKey | AFBQPCRDHJMZTE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|