C15H19F3N4O2S — CID 8790320
2-(2-morpholin-4-ylethylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 8790320) has the molecular formula C15H19F3N4O2S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(2-morpholin-4-ylethylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 8790320 |
| Molecular Formula | C15H19F3N4O2S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-(2-morpholin-4-ylethylcarbamothioylamino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNC(=S)NCCN1CCOCC1)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H19F3N4O2S/c16-10-1-2-11(14(18)13(10)17)21-12(23)9-20-15(25)19-3-4-22-5-7-24-8-6-22/h1-2H,3-9H2,(H,21,23)(H2,19,20,25) |
| InChIKey | YDVCMIJVIARFML-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|