C21H30F3N5O2 — CID 111003751
2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 111003751) has the molecular formula C21H30F3N5O2 and a molecular weight of 441.50 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 111003751 |
| Molecular Formula | C21H30F3N5O2 |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C21H30F3N5O2/c1-25-20(26-13-17(30)28-16-6-5-15(22)18(23)19(16)24)27-14-21(7-3-2-4-8-21)29-9-11-31-12-10-29/h5-6H,2-4,7-14H2,1H3,(H,28,30)(H2,25,26,27) |
| InChIKey | JUBAKOPRQXPFLT-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|