C19H37N5O2 — CID 111003765
N-tert-butyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111003765) has the molecular formula C19H37N5O2 and a molecular weight of 367.54 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111003765 |
| Molecular Formula | C19H37N5O2 |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.29 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(1-morpholin-4-ylcyclohexyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC1(N2CCOCC2)CCCCC1 |
| InChI | InChI=1S/C19H37N5O2/c1-18(2,3)23-16(25)14-21-17(20-4)22-15-19(8-6-5-7-9-19)24-10-12-26-13-11-24/h5-15H2,1-4H3,(H,23,25)(H2,20,21,22) |
| InChIKey | HOCQPLANCLVALK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|