C18H35N5OS — CID 111383279
N-tert-butyl-2-[[N'-methyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]acetamide (PubChem CID 111383279) has the molecular formula C18H35N5OS and a molecular weight of 369.58 g/mol. Its IUPAC name is N-tert-butyl-2-[[N'-methyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N'-methyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111383279 |
| Molecular Formula | C18H35N5OS |
| Molecular Weight | 369.58 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | N-tert-butyl-2-[[N'-methyl-N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCC1(N2CCSCC2)CCCC1 |
| InChI | InChI=1S/C18H35N5OS/c1-17(2,3)22-15(24)13-20-16(19-4)21-14-18(7-5-6-8-18)23-9-11-25-12-10-23/h5-14H2,1-4H3,(H,22,24)(H2,19,20,21) |
| InChIKey | HAHYUNIOLXSXLM-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.58 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|