C18H32N6S — CID 111906507
2-methyl-1-(3-pyrazol-1-ylpropyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine (PubChem CID 111906507) has the molecular formula C18H32N6S and a molecular weight of 364.56 g/mol. Its IUPAC name is 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine.
| Compound Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111906507 |
| Molecular Formula | C18H32N6S |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | 2-methyl-1-(3-pyrazol-1-ylpropyl)-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCn1cccn1)NCC1(N2CCSCC2)CCCC1 |
| InChI | InChI=1S/C18H32N6S/c1-19-17(20-8-4-10-24-11-5-9-22-24)21-16-18(6-2-3-7-18)23-12-14-25-15-13-23/h5,9,11H,2-4,6-8,10,12-16H2,1H3,(H2,19,20,21) |
| InChIKey | SNBXQGHXNIJODG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|