C20H37IN6S — CID 111280238
1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide (PubChem CID 111280238) has the molecular formula C20H37IN6S and a molecular weight of 520.53 g/mol. Its IUPAC name is 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111280238 |
| Molecular Formula | C20H37IN6S |
| Molecular Weight | 520.53 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | 1-[3-(3,5-dimethylpyrazol-1-yl)propyl]-2-methyl-3-[(1-thiomorpholin-4-ylcyclopentyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCn1nc(C)cc1C)NCC1(N2CCSCC2)CCCC1.I |
| InChI | InChI=1S/C20H36N6S.HI/c1-17-15-18(2)26(24-17)10-6-9-22-19(21-3)23-16-20(7-4-5-8-20)25-11-13-27-14-12-25;/h15H,4-14,16H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | HGYKEIAZMLTSEN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 57.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.53 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|