C20H34IN5S — CID 111828418
2-methyl-1-(2-pyridin-2-ylethyl)-3-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide (PubChem CID 111828418) has the molecular formula C20H34IN5S and a molecular weight of 503.50 g/mol. Its IUPAC name is 2-methyl-1-(2-pyridin-2-ylethyl)-3-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111828418 |
| Molecular Formula | C20H34IN5S |
| Molecular Weight | 503.50 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 2-methyl-1-(2-pyridin-2-ylethyl)-3-[(1-thiomorpholin-4-ylcyclohexyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCCc1ccccn1)NCC1(N2CCSCC2)CCCCC1.I |
| InChI | InChI=1S/C20H33N5S.HI/c1-21-19(23-12-8-18-7-3-6-11-22-18)24-17-20(9-4-2-5-10-20)25-13-15-26-16-14-25;/h3,6-7,11H,2,4-5,8-10,12-17H2,1H3,(H2,21,23,24);1H |
| InChIKey | LKVMUCWHUZTPGO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.50 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|