C20H22F3IN4OS — CID 111557041
2-[[N'-methyl-N-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111557041) has the molecular formula C20H22F3IN4OS and a molecular weight of 550.39 g/mol. Its IUPAC name is 2-[[N'-methyl-N-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-methyl-N-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111557041 |
| Molecular Formula | C20H22F3IN4OS |
| Molecular Weight | 550.39 g/mol |
| Exact Mass | 550.05 |
| IUPAC Name | 2-[[N'-methyl-N-[(1-phenylsulfanylcyclopropyl)methyl]carbamimidoyl]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | C/N=C(/NCC(=O)Nc1ccc(F)c(F)c1F)NCC1(Sc2ccccc2)CC1.I |
| InChI | InChI=1S/C20H21F3N4OS.HI/c1-24-19(26-12-20(9-10-20)29-13-5-3-2-4-6-13)25-11-16(28)27-15-8-7-14(21)17(22)18(15)23;/h2-8H,9-12H2,1H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | IIUVLKICCDXHLX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.39 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|