C15H20F3N3O4S — CID 113157492
N-(2-morpholin-4-ylethyl)-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide (PubChem CID 113157492) has the molecular formula C15H20F3N3O4S and a molecular weight of 395.40 g/mol. Its IUPAC name is N-(2-morpholin-4-ylethyl)-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide.
| Compound Name | N-(2-morpholin-4-ylethyl)-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide |
|---|---|
| PubChem CID | 113157492 |
| Molecular Formula | C15H20F3N3O4S |
| Molecular Weight | 395.40 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(2-morpholin-4-ylethyl)-2-(2,3,4-trifluoro-N-methylsulfonylanilino)acetamide |
| SMILES | CS(=O)(=O)N(CC(=O)NCCN1CCOCC1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H20F3N3O4S/c1-26(23,24)21(12-3-2-11(16)14(17)15(12)18)10-13(22)19-4-5-20-6-8-25-9-7-20/h2-3H,4-10H2,1H3,(H,19,22) |
| InChIKey | ITGVDOINLXYPDR-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|