C14H20IN3OS — CID 23964682
1-(4-iodo-2-methylphenyl)-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 23964682) has the molecular formula C14H20IN3OS and a molecular weight of 405.31 g/mol. Its IUPAC name is 1-(4-iodo-2-methylphenyl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(4-iodo-2-methylphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 23964682 |
| Molecular Formula | C14H20IN3OS |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 1-(4-iodo-2-methylphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | Cc1cc(I)ccc1NC(=S)NCCN1CCOCC1 |
| InChI | InChI=1S/C14H20IN3OS/c1-11-10-12(15)2-3-13(11)17-14(20)16-4-5-18-6-8-19-9-7-18/h2-3,10H,4-9H2,1H3,(H2,16,17,20) |
| InChIKey | LMAFCXYNDFDJHV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|