C19H30N4O4S2 — CID 23963884
1-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 23963884) has the molecular formula C19H30N4O4S2 and a molecular weight of 442.61 g/mol. Its IUPAC name is 1-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 23963884 |
| Molecular Formula | C19H30N4O4S2 |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 1-(4-methoxy-2-piperidin-1-ylsulfonylphenyl)-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(NC(=S)NCCN2CCOCC2)c(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H30N4O4S2/c1-26-16-5-6-17(18(15-16)29(24,25)23-8-3-2-4-9-23)21-19(28)20-7-10-22-11-13-27-14-12-22/h5-6,15H,2-4,7-14H2,1H3,(H2,20,21,28) |
| InChIKey | BLBUCUQTGGXQEO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|