C16H25N3O3S — CID 2400156
1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 2400156) has the molecular formula C16H25N3O3S and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 2400156 |
| Molecular Formula | C16H25N3O3S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COc1ccc(CNC(=S)NCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C16H25N3O3S/c1-20-14-4-3-13(11-15(14)21-2)12-18-16(23)17-5-6-19-7-9-22-10-8-19/h3-4,11H,5-10,12H2,1-2H3,(H2,17,18,23) |
| InChIKey | SZUQIGBJGUMUCT-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 54.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|