C17H25N3O5 — CID 108944084
N'-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)propanediamide (PubChem CID 108944084) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is N'-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)propanediamide.
| Compound Name | N'-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)propanediamide |
|---|---|
| PubChem CID | 108944084 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N'-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-ylethyl)propanediamide |
| SMILES | COc1ccc(NC(=O)CC(=O)NCCN2CCOCC2)cc1OC |
| InChI | InChI=1S/C17H25N3O5/c1-23-14-4-3-13(11-15(14)24-2)19-17(22)12-16(21)18-5-6-20-7-9-25-10-8-20/h3-4,11H,5-10,12H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | IEHZARQLICAXMJ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|