C20H24N4O5S — CID 5235420
[2-methoxy-4-[(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenyl] furan-2-carboxylate (PubChem CID 5235420) has the molecular formula C20H24N4O5S and a molecular weight of 432.50 g/mol. Its IUPAC name is [2-methoxy-4-[(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenyl] furan-2-carboxylate.
| Compound Name | [2-methoxy-4-[(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 5235420 |
| Molecular Formula | C20H24N4O5S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [2-methoxy-4-[(2-morpholin-4-ylethylcarbamothioylhydrazinylidene)methyl]phenyl] furan-2-carboxylate |
| SMILES | COc1cc(C=NNC(=S)NCCN2CCOCC2)ccc1OC(=O)c1ccco1 |
| InChI | InChI=1S/C20H24N4O5S/c1-26-18-13-15(4-5-16(18)29-19(25)17-3-2-10-28-17)14-22-23-20(30)21-6-7-24-8-11-27-12-9-24/h2-5,10,13-14H,6-9,11-12H2,1H3,(H2,21,23,30) |
| InChIKey | LKDXORVYEPNMHJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|