C15H12F4N2O3S — CID 113002239
2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 113002239) has the molecular formula C15H12F4N2O3S and a molecular weight of 376.33 g/mol. Its IUPAC name is 2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 113002239 |
| Molecular Formula | C15H12F4N2O3S |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | 2-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | Cc1cc(S(=O)(=O)NCC(=O)Nc2ccc(F)c(F)c2F)ccc1F |
| InChI | InChI=1S/C15H12F4N2O3S/c1-8-6-9(2-3-10(8)16)25(23,24)20-7-13(22)21-12-5-4-11(17)14(18)15(12)19/h2-6,20H,7H2,1H3,(H,21,22) |
| InChIKey | HGTYFJMQOXVNNF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|