C17H15F3N2O5S — CID 26943463
2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 26943463) has the molecular formula C17H15F3N2O5S and a molecular weight of 416.38 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 26943463 |
| Molecular Formula | C17H15F3N2O5S |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc2c(c1)OCCCO2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C17H15F3N2O5S/c18-11-3-4-12(17(20)16(11)19)22-15(23)9-21-28(24,25)10-2-5-13-14(8-10)27-7-1-6-26-13/h2-5,8,21H,1,6-7,9H2,(H,22,23) |
| InChIKey | MKUAFPDRPJKIOV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|