C19H20ClNO7S — CID 41349157
2-(4-chlorophenoxy)ethyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate (PubChem CID 41349157) has the molecular formula C19H20ClNO7S and a molecular weight of 441.89 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)ethyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate.
| Compound Name | 2-(4-chlorophenoxy)ethyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 41349157 |
| Molecular Formula | C19H20ClNO7S |
| Molecular Weight | 441.89 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-(4-chlorophenoxy)ethyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccc2c(c1)OCCCO2)OCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H20ClNO7S/c20-14-2-4-15(5-3-14)25-10-11-28-19(22)13-21-29(23,24)16-6-7-17-18(12-16)27-9-1-8-26-17/h2-7,12,21H,1,8-11,13H2 |
| InChIKey | HJLOQWFBAKZQEO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.89 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|