C15H18N6O6S — CID 55391989
(4,6-diamino-1,3,5-triazin-2-yl)methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate (PubChem CID 55391989) has the molecular formula C15H18N6O6S and a molecular weight of 410.41 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate |
|---|---|
| PubChem CID | 55391989 |
| Molecular Formula | C15H18N6O6S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylsulfonylamino)acetate |
| SMILES | Nc1nc(N)nc(COC(=O)CNS(=O)(=O)c2ccc3c(c2)OCCCO3)n1 |
| InChI | InChI=1S/C15H18N6O6S/c16-14-19-12(20-15(17)21-14)8-27-13(22)7-18-28(23,24)9-2-3-10-11(6-9)26-5-1-4-25-10/h2-3,6,18H,1,4-5,7-8H2,(H4,16,17,19,20,21) |
| InChIKey | WACSVRLMZCLMAD-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 181.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |