C12H16N2S2 — CID 8564789
1-(2-methylprop-2-enyl)-3-(4-methylsulfanylphenyl)thiourea (PubChem CID 8564789) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-(4-methylsulfanylphenyl)thiourea.
| Compound Name | 1-(2-methylprop-2-enyl)-3-(4-methylsulfanylphenyl)thiourea |
|---|---|
| PubChem CID | 8564789 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-(4-methylsulfanylphenyl)thiourea |
| SMILES | C=C(C)CNC(=S)Nc1ccc(SC)cc1 |
| InChI | InChI=1S/C12H16N2S2/c1-9(2)8-13-12(15)14-10-4-6-11(16-3)7-5-10/h4-7H,1,8H2,2-3H3,(H2,13,14,15) |
| InChIKey | PVWNJLMKWGTOHJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|