C7H11N5S — CID 4243256
1-(2-methylprop-2-enyl)-3-(1H-1,2,4-triazol-5-yl)thiourea (PubChem CID 4243256) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 1-(2-methylprop-2-enyl)-3-(1H-1,2,4-triazol-5-yl)thiourea.
| Compound Name | 1-(2-methylprop-2-enyl)-3-(1H-1,2,4-triazol-5-yl)thiourea |
|---|---|
| PubChem CID | 4243256 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 1-(2-methylprop-2-enyl)-3-(1H-1,2,4-triazol-5-yl)thiourea |
| SMILES | C=C(C)CNC(=S)Nc1ncn[nH]1 |
| InChI | InChI=1S/C7H11N5S/c1-5(2)3-8-7(13)11-6-9-4-10-12-6/h4H,1,3H2,2H3,(H3,8,9,10,11,12,13) |
| InChIKey | KHLHXHNGWCBHQE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 65.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|