C7H11N5S — CID 71484987
5-amino-N-(2-methylprop-2-enyl)-1,2,4-triazole-1-carbothioamide (PubChem CID 71484987) has the molecular formula C7H11N5S and a molecular weight of 197.27 g/mol. Its IUPAC name is 5-amino-N-(2-methylprop-2-enyl)-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-N-(2-methylprop-2-enyl)-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 71484987 |
| Molecular Formula | C7H11N5S |
| Molecular Weight | 197.27 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-amino-N-(2-methylprop-2-enyl)-1,2,4-triazole-1-carbothioamide |
| SMILES | C=C(C)CNC(=S)n1ncnc1N |
| InChI | InChI=1S/C7H11N5S/c1-5(2)3-9-7(13)12-6(8)10-4-11-12/h4H,1,3H2,2H3,(H,9,13)(H2,8,10,11) |
| InChIKey | BXESTWNSJKRJJO-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.27 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|